C25H34NO4PS — CID 134918785
methyl (2R)-3-bis(3,5-dimethylphenyl)phosphinothioyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 134918785) has the molecular formula C25H34NO4PS and a molecular weight of 475.59 g/mol. Its IUPAC name is methyl (2R)-3-bis(3,5-dimethylphenyl)phosphinothioyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2R)-3-bis(3,5-dimethylphenyl)phosphinothioyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 134918785 |
| Molecular Formula | C25H34NO4PS |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | methyl (2R)-3-bis(3,5-dimethylphenyl)phosphinothioyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](CP(=S)(c1cc(C)cc(C)c1)c1cc(C)cc(C)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34NO4PS/c1-16-9-17(2)12-20(11-16)31(32,21-13-18(3)10-19(4)14-21)15-22(23(27)29-8)26-24(28)30-25(5,6)7/h9-14,22H,15H2,1-8H3,(H,26,28)/t22-/m0/s1 |
| InChIKey | MQSXDIZBDMVFHJ-QFIPXVFZSA-N |
| XLogP | 4.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|