C24H25ClNO4P — CID 22210411
2-(1-carboxyethylcarbamoyloxy)ethyl-triphenylphosphanium chloride (PubChem CID 22210411) has the molecular formula C24H25ClNO4P and a molecular weight of 457.89 g/mol. Its IUPAC name is 2-(1-carboxyethylcarbamoyloxy)ethyl-triphenylphosphanium chloride.
| Compound Name | 2-(1-carboxyethylcarbamoyloxy)ethyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 22210411 |
| Molecular Formula | C24H25ClNO4P |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-(1-carboxyethylcarbamoyloxy)ethyl-triphenylphosphanium chloride |
| SMILES | CC(NC(=O)OCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O.[Cl-] |
| InChI | InChI=1S/C24H24NO4P.ClH/c1-19(23(26)27)25-24(28)29-17-18-30(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22;/h2-16,19H,17-18H2,1H3,(H-,25,26,27,28);1H |
| InChIKey | NIIHIJBWARHWQA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|