C15H21NO3Se — CID 15408407
tert-butyl N-[(2S,3S)-4-oxo-3-phenylselanylbutan-2-yl]carbamate (PubChem CID 15408407) has the molecular formula C15H21NO3Se and a molecular weight of 342.30 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-4-oxo-3-phenylselanylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-4-oxo-3-phenylselanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 15408407 |
| Molecular Formula | C15H21NO3Se |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | tert-butyl N-[(2S,3S)-4-oxo-3-phenylselanylbutan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)[C@@H](C=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C15H21NO3Se/c1-11(16-14(18)19-15(2,3)4)13(10-17)20-12-8-6-5-7-9-12/h5-11,13H,1-4H3,(H,16,18)/t11-,13+/m0/s1 |
| InChIKey | UYRNIMMZUPEKKS-WCQYABFASA-N |
| XLogP | 1.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|