C17H25NO3Se — CID 15408412
tert-butyl N-[(2S,3S)-4-methyl-1-oxo-2-phenylselanylpentan-3-yl]carbamate (PubChem CID 15408412) has the molecular formula C17H25NO3Se and a molecular weight of 370.35 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-4-methyl-1-oxo-2-phenylselanylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-4-methyl-1-oxo-2-phenylselanylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 15408412 |
| Molecular Formula | C17H25NO3Se |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | tert-butyl N-[(2S,3S)-4-methyl-1-oxo-2-phenylselanylpentan-3-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)[C@@H](C=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C17H25NO3Se/c1-12(2)15(18-16(20)21-17(3,4)5)14(11-19)22-13-9-7-6-8-10-13/h6-12,14-15H,1-5H3,(H,18,20)/t14-,15+/m1/s1 |
| InChIKey | PQHVRRDFRNCCFS-CABCVRRESA-N |
| XLogP | 2.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|