C16H23NO4Se — CID 58618369
phenylselanyl (2R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trideuteriomethyl)butanoate (PubChem CID 58618369) has the molecular formula C16H23NO4Se and a molecular weight of 375.34 g/mol. Its IUPAC name is phenylselanyl (2R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trideuteriomethyl)butanoate.
| Compound Name | phenylselanyl (2R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trideuteriomethyl)butanoate |
|---|---|
| PubChem CID | 58618369 |
| Molecular Formula | C16H23NO4Se |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | phenylselanyl (2R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trideuteriomethyl)butanoate |
| SMILES | [2H]C([2H])([2H])[C@@H](C(=O)O[Se]c1ccccc1)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO4Se/c1-11(12(2)17-15(19)20-16(3,4)5)14(18)21-22-13-9-7-6-8-10-13/h6-12H,1-5H3,(H,17,19)/t11-,12-/m1/s1/i1D3 |
| InChIKey | GUOCZUWGWCZMOY-GOLXAPTQSA-N |
| XLogP | 2.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|