C20H31NO4Si — CID 10571659
methyl (2S,3R)-4-[dimethyl(phenyl)silyl]-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 10571659) has the molecular formula C20H31NO4Si and a molecular weight of 377.56 g/mol. Its IUPAC name is methyl (2S,3R)-4-[dimethyl(phenyl)silyl]-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | methyl (2S,3R)-4-[dimethyl(phenyl)silyl]-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 10571659 |
| Molecular Formula | C20H31NO4Si |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | methyl (2S,3R)-4-[dimethyl(phenyl)silyl]-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=C([C@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)OC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H31NO4Si/c1-14(15(2)26(7,8)16-12-10-9-11-13-16)17(18(22)24-6)21-19(23)25-20(3,4)5/h9-14,17H,2H2,1,3-8H3,(H,21,23)/t14-,17-/m0/s1 |
| InChIKey | XXCVXFWDAWDHKK-YOEHRIQHSA-N |
| XLogP | 3.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|