C20H33NO4SeSi — CID 134918588
2-trimethylsilylethyl (2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylselanylbutanoate (PubChem CID 134918588) has the molecular formula C20H33NO4SeSi and a molecular weight of 458.53 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylselanylbutanoate.
| Compound Name | 2-trimethylsilylethyl (2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylselanylbutanoate |
|---|---|
| PubChem CID | 134918588 |
| Molecular Formula | C20H33NO4SeSi |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 2-trimethylsilylethyl (2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylselanylbutanoate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)[C@H]([Se]c1ccccc1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C20H33NO4SeSi/c1-15(21-19(23)25-20(2,3)4)17(26-16-11-9-8-10-12-16)18(22)24-13-14-27(5,6)7/h8-12,15,17H,13-14H2,1-7H3,(H,21,23)/t15-,17-/m0/s1 |
| InChIKey | JDGZBUCREZTPMR-RDJZCZTQSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|