C17H25NO2Si — CID 11381145
tert-butyl N-[4-[dimethyl(phenyl)silyl]buta-2,3-dienyl]carbamate (PubChem CID 11381145) has the molecular formula C17H25NO2Si and a molecular weight of 303.48 g/mol. Its IUPAC name is tert-butyl N-[4-[dimethyl(phenyl)silyl]buta-2,3-dienyl]carbamate.
| Compound Name | tert-butyl N-[4-[dimethyl(phenyl)silyl]buta-2,3-dienyl]carbamate |
|---|---|
| PubChem CID | 11381145 |
| Molecular Formula | C17H25NO2Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | tert-butyl N-[4-[dimethyl(phenyl)silyl]buta-2,3-dienyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=C=C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2Si/c1-17(2,3)20-16(19)18-13-9-10-14-21(4,5)15-11-7-6-8-12-15/h6-9,11-12,14H,13H2,1-5H3,(H,18,19) |
| InChIKey | TZJACMYQFXKZAV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|