C19H31NO3Si — CID 100997661
tert-butyl N-[(2S)-1-[dimethyl(phenyl)silyl]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 100997661) has the molecular formula C19H31NO3Si and a molecular weight of 349.55 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[dimethyl(phenyl)silyl]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[dimethyl(phenyl)silyl]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 100997661 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-[dimethyl(phenyl)silyl]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H31NO3Si/c1-8-14(2)16(20-18(22)23-19(3,4)5)17(21)24(6,7)15-12-10-9-11-13-15/h9-14,16H,8H2,1-7H3,(H,20,22)/t14?,16-/m0/s1 |
| InChIKey | FLVKWKYWOPHMGC-WMCAAGNKSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|