C24H40N2O3Si — CID 10862968
tert-butyl N-[(2S,3R)-1-(diethylamino)-4-[dimethyl(phenyl)silyl]-2,3-dimethyl-1-oxopent-4-en-2-yl]carbamate (PubChem CID 10862968) has the molecular formula C24H40N2O3Si and a molecular weight of 432.68 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1-(diethylamino)-4-[dimethyl(phenyl)silyl]-2,3-dimethyl-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-1-(diethylamino)-4-[dimethyl(phenyl)silyl]-2,3-dimethyl-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10862968 |
| Molecular Formula | C24H40N2O3Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1-(diethylamino)-4-[dimethyl(phenyl)silyl]-2,3-dimethyl-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=C([C@H](C)[C@](C)(NC(=O)OC(C)(C)C)C(=O)N(CC)CC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H40N2O3Si/c1-11-26(12-2)21(27)24(8,25-22(28)29-23(5,6)7)18(3)19(4)30(9,10)20-16-14-13-15-17-20/h13-18H,4,11-12H2,1-3,5-10H3,(H,25,28)/t18-,24-/m0/s1 |
| InChIKey | PFEKJPXRTFPTEK-UUOWRZLLSA-N |
| XLogP | 4.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|