C21H34N2O3Si — CID 10572507
tert-butyl N-[(2S,3R)-1-(dimethylamino)-4-[dimethyl(phenyl)silyl]-3-methyl-1-oxopent-4-en-2-yl]carbamate (PubChem CID 10572507) has the molecular formula C21H34N2O3Si and a molecular weight of 390.60 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1-(dimethylamino)-4-[dimethyl(phenyl)silyl]-3-methyl-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-1-(dimethylamino)-4-[dimethyl(phenyl)silyl]-3-methyl-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10572507 |
| Molecular Formula | C21H34N2O3Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1-(dimethylamino)-4-[dimethyl(phenyl)silyl]-3-methyl-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=C([C@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)N(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H34N2O3Si/c1-15(16(2)27(8,9)17-13-11-10-12-14-17)18(19(24)23(6)7)22-20(25)26-21(3,4)5/h10-15,18H,2H2,1,3-9H3,(H,22,25)/t15-,18-/m0/s1 |
| InChIKey | FYOBYDSVEKRBEM-YJBOKZPZSA-N |
| XLogP | 3.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|