C20H32N2O3Si — CID 10571594
tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-[2-(methylamino)-2-oxoethyl]carbamate (PubChem CID 10571594) has the molecular formula C20H32N2O3Si and a molecular weight of 376.57 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-[2-(methylamino)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-[2-(methylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 10571594 |
| Molecular Formula | C20H32N2O3Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-[2-(methylamino)-2-oxoethyl]carbamate |
| SMILES | C/C=C(/CN(CC(=O)NC)C(=O)OC(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H32N2O3Si/c1-8-16(26(6,7)17-12-10-9-11-13-17)14-22(15-18(23)21-5)19(24)25-20(2,3)4/h8-13H,14-15H2,1-7H3,(H,21,23)/b16-8- |
| InChIKey | UCFHMIFQBRDJAW-PXNMLYILSA-N |
| XLogP | 3.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|