C28H41N3O4Si — CID 138980071
tert-butyl N-[(4R)-4-acetamido-4-[[(2S)-2-methyl-3-(methylamino)-3-oxopropyl]-diphenylsilyl]butyl]carbamate (PubChem CID 138980071) has the molecular formula C28H41N3O4Si and a molecular weight of 511.74 g/mol. Its IUPAC name is tert-butyl N-[(4R)-4-acetamido-4-[[(2S)-2-methyl-3-(methylamino)-3-oxopropyl]-diphenylsilyl]butyl]carbamate.
| Compound Name | tert-butyl N-[(4R)-4-acetamido-4-[[(2S)-2-methyl-3-(methylamino)-3-oxopropyl]-diphenylsilyl]butyl]carbamate |
|---|---|
| PubChem CID | 138980071 |
| Molecular Formula | C28H41N3O4Si |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | tert-butyl N-[(4R)-4-acetamido-4-[[(2S)-2-methyl-3-(methylamino)-3-oxopropyl]-diphenylsilyl]butyl]carbamate |
| SMILES | CNC(=O)[C@H](C)C[Si](c1ccccc1)(c1ccccc1)[C@H](CCCNC(=O)OC(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C28H41N3O4Si/c1-21(26(33)29-6)20-36(23-14-9-7-10-15-23,24-16-11-8-12-17-24)25(31-22(2)32)18-13-19-30-27(34)35-28(3,4)5/h7-12,14-17,21,25H,13,18-20H2,1-6H3,(H,29,33)(H,30,34)(H,31,32)/t21-,25-/m1/s1 |
| InChIKey | TXJAAYNWDLFIDL-PXDATVDWSA-N |
| XLogP | 2.98 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|