C25H37NO3Si — CID 138983254
tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxybutyl]carbamate (PubChem CID 138983254) has the molecular formula C25H37NO3Si and a molecular weight of 427.66 g/mol. Its IUPAC name is tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxybutyl]carbamate |
|---|---|
| PubChem CID | 138983254 |
| Molecular Formula | C25H37NO3Si |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H37NO3Si/c1-24(2,3)29-23(27)26-19-13-14-20-28-30(25(4,5)6,21-15-9-7-10-16-21)22-17-11-8-12-18-22/h7-12,15-18H,13-14,19-20H2,1-6H3,(H,26,27) |
| InChIKey | BILJXKRTQYKAJU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|