C22H29NO2Si — CID 134905367
tert-butyl N-[1-[methyl(diphenyl)silyl]but-3-enyl]carbamate (PubChem CID 134905367) has the molecular formula C22H29NO2Si and a molecular weight of 367.57 g/mol. Its IUPAC name is tert-butyl N-[1-[methyl(diphenyl)silyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[1-[methyl(diphenyl)silyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 134905367 |
| Molecular Formula | C22H29NO2Si |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | tert-butyl N-[1-[methyl(diphenyl)silyl]but-3-enyl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO2Si/c1-6-13-20(23-21(24)25-22(2,3)4)26(5,18-14-9-7-10-15-18)19-16-11-8-12-17-19/h6-12,14-17,20H,1,13H2,2-5H3,(H,23,24) |
| InChIKey | IAYKRCIIPIWHJJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|