C25H36FNO3Si — CID 140870521
tert-butyl N-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-2-methylpropyl]carbamate (PubChem CID 140870521) has the molecular formula C25H36FNO3Si and a molecular weight of 445.65 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 140870521 |
| Molecular Formula | C25H36FNO3Si |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | tert-butyl N-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-2-methylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@](C)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36FNO3Si/c1-23(2,3)30-22(28)27-18-25(7,26)19-29-31(24(4,5)6,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17H,18-19H2,1-7H3,(H,27,28)/t25-/m0/s1 |
| InChIKey | AAUCQEKGLKEMHO-VWLOTQADSA-N |
| XLogP | 4.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|