C26H29NO2Si — CID 11373383
tert-butyl N-[(1S)-1-triphenylsilylprop-2-enyl]carbamate (PubChem CID 11373383) has the molecular formula C26H29NO2Si and a molecular weight of 415.61 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-triphenylsilylprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-triphenylsilylprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 11373383 |
| Molecular Formula | C26H29NO2Si |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | tert-butyl N-[(1S)-1-triphenylsilylprop-2-enyl]carbamate |
| SMILES | C=C[C@@H](NC(=O)OC(C)(C)C)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2Si/c1-5-24(27-25(28)29-26(2,3)4)30(21-15-9-6-10-16-21,22-17-11-7-12-18-22)23-19-13-8-14-20-23/h5-20,24H,1H2,2-4H3,(H,27,28)/t24-/m0/s1 |
| InChIKey | KNXFPPGYYMSZGW-DEOSSOPVSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|