C25H29NO2Si — CID 15313504
tert-butyl N-[[methyl(diphenyl)silyl]-phenylmethyl]carbamate (PubChem CID 15313504) has the molecular formula C25H29NO2Si and a molecular weight of 403.60 g/mol. Its IUPAC name is tert-butyl N-[[methyl(diphenyl)silyl]-phenylmethyl]carbamate.
| Compound Name | tert-butyl N-[[methyl(diphenyl)silyl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 15313504 |
| Molecular Formula | C25H29NO2Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | tert-butyl N-[[methyl(diphenyl)silyl]-phenylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccccc1)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NO2Si/c1-25(2,3)28-24(27)26-23(20-14-8-5-9-15-20)29(4,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19,23H,1-4H3,(H,26,27) |
| InChIKey | GADOWNVLJHNMDF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|