C23H36N2O4Si — CID 10598870
tert-butyl N-[(2S,3R)-4-[dimethyl(phenyl)silyl]-3-methyl-1-morpholin-4-yl-1-oxopent-4-en-2-yl]carbamate (PubChem CID 10598870) has the molecular formula C23H36N2O4Si and a molecular weight of 432.64 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-[dimethyl(phenyl)silyl]-3-methyl-1-morpholin-4-yl-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-[dimethyl(phenyl)silyl]-3-methyl-1-morpholin-4-yl-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10598870 |
| Molecular Formula | C23H36N2O4Si |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-[dimethyl(phenyl)silyl]-3-methyl-1-morpholin-4-yl-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=C([C@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCOCC1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H36N2O4Si/c1-17(18(2)30(6,7)19-11-9-8-10-12-19)20(24-22(27)29-23(3,4)5)21(26)25-13-15-28-16-14-25/h8-12,17,20H,2,13-16H2,1,3-7H3,(H,24,27)/t17-,20-/m0/s1 |
| InChIKey | RGDDNVPZJMOMHE-PXNSSMCTSA-N |
| XLogP | 3.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|