C21H36N2OSi — CID 10959358
2-[[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]amino]-N,N-diethyl-3-methylbutanamide (PubChem CID 10959358) has the molecular formula C21H36N2OSi and a molecular weight of 360.62 g/mol. Its IUPAC name is 2-[[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]amino]-N,N-diethyl-3-methylbutanamide.
| Compound Name | 2-[[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]amino]-N,N-diethyl-3-methylbutanamide |
|---|---|
| PubChem CID | 10959358 |
| Molecular Formula | C21H36N2OSi |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 2-[[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]amino]-N,N-diethyl-3-methylbutanamide |
| SMILES | C/C=C(/CNC(C(=O)N(CC)CC)C(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H36N2OSi/c1-8-18(25(6,7)19-14-12-11-13-15-19)16-22-20(17(4)5)21(24)23(9-2)10-3/h8,11-15,17,20,22H,9-10,16H2,1-7H3/b18-8- |
| InChIKey | PEOSHBVYSOTHCY-LSCVHKIXSA-N |
| XLogP | 3.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|