C22H27NO3Si — CID 134950136
(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-1,3-oxazolidin-2-one (PubChem CID 134950136) has the molecular formula C22H27NO3Si and a molecular weight of 381.55 g/mol. Its IUPAC name is (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134950136 |
| Molecular Formula | C22H27NO3Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H]1OC(=O)N[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H27NO3Si/c1-5-20-19(23-21(24)26-20)16-25-27(22(2,3)4,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h5-15,19-20H,1,16H2,2-4H3,(H,23,24)/t19-,20-/m1/s1 |
| InChIKey | OFRZMACLIDFPGX-WOJBJXKFSA-N |
| XLogP | 3.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|