C33H45NO3Si — CID 11353085
tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxydodeca-4,10-diyn-2-yl]carbamate (PubChem CID 11353085) has the molecular formula C33H45NO3Si and a molecular weight of 531.81 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxydodeca-4,10-diyn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxydodeca-4,10-diyn-2-yl]carbamate |
|---|---|
| PubChem CID | 11353085 |
| Molecular Formula | C33H45NO3Si |
| Molecular Weight | 531.81 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxydodeca-4,10-diyn-2-yl]carbamate |
| SMILES | CC#CCCCCC#CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H45NO3Si/c1-8-9-10-11-12-13-14-17-22-28(34-31(35)37-32(2,3)4)27-36-38(33(5,6)7,29-23-18-15-19-24-29)30-25-20-16-21-26-30/h15-16,18-21,23-26,28H,10-13,22,27H2,1-7H3,(H,34,35)/t28-/m0/s1 |
| InChIKey | FJHLBQFHJQZYEI-NDEPHWFRSA-N |
| XLogP | 6.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.81 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|