C23H31NO4Si — CID 11281400
(4R,5R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-5-ethyl-1,3-oxazolidin-2-one (PubChem CID 11281400) has the molecular formula C23H31NO4Si and a molecular weight of 413.59 g/mol. Its IUPAC name is (4R,5R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-5-ethyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-5-ethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11281400 |
| Molecular Formula | C23H31NO4Si |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (4R,5R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-5-ethyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@H]1OC(=O)N[C@@H]1[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H31NO4Si/c1-5-20-21(24-22(26)28-20)19(25)16-27-29(23(2,3)4,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15,19-21,25H,5,16H2,1-4H3,(H,24,26)/t19-,20-,21-/m1/s1 |
| InChIKey | OUUWFRHDXAHIOG-NJDAHSKKSA-N |
| XLogP | 2.81 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|