C30H44N4O6Si — CID 56926559
tert-butyl N-[(1S)-1-[(4R,5R)-5-[(1S)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl]carbamate (PubChem CID 56926559) has the molecular formula C30H44N4O6Si and a molecular weight of 584.79 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(4R,5R)-5-[(1S)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(4R,5R)-5-[(1S)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 56926559 |
| Molecular Formula | C30H44N4O6Si |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(4R,5R)-5-[(1S)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1[C@@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C30H44N4O6Si/c1-28(2,3)40-27(36)33-23(25-26(24(35)19-32-34-31)39-30(7,8)38-25)20-37-41(29(4,5)6,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,23-26,35H,19-20H2,1-8H3,(H,33,36)/t23-,24-,25+,26+/m0/s1 |
| InChIKey | IPAPURNQEVMANH-QEGGNFSNSA-N |
| XLogP | 4.65 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|