C26H38N4O4Si — CID 162415528
tert-butyl N-[(2S,4R)-5-azido-1-[tert-butyl(diphenyl)silyl]oxy-4-hydroxypentan-2-yl]carbamate (PubChem CID 162415528) has the molecular formula C26H38N4O4Si and a molecular weight of 498.70 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-5-azido-1-[tert-butyl(diphenyl)silyl]oxy-4-hydroxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-5-azido-1-[tert-butyl(diphenyl)silyl]oxy-4-hydroxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 162415528 |
| Molecular Formula | C26H38N4O4Si |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | tert-butyl N-[(2S,4R)-5-azido-1-[tert-butyl(diphenyl)silyl]oxy-4-hydroxypentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C26H38N4O4Si/c1-25(2,3)34-24(32)29-20(17-21(31)18-28-30-27)19-33-35(26(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,20-21,31H,17-19H2,1-6H3,(H,29,32)/t20-,21+/m0/s1 |
| InChIKey | SAKNPZDNFSKIGA-LEWJYISDSA-N |
| XLogP | 4.52 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|