C29H41NO4Si — CID 102450327
tert-butyl N-[(3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyocta-1,7-dien-4-yl]carbamate (PubChem CID 102450327) has the molecular formula C29H41NO4Si and a molecular weight of 495.74 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyocta-1,7-dien-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyocta-1,7-dien-4-yl]carbamate |
|---|---|
| PubChem CID | 102450327 |
| Molecular Formula | C29H41NO4Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl N-[(3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyocta-1,7-dien-4-yl]carbamate |
| SMILES | C=CCC(O)[C@H](NC(=O)OC(C)(C)C)[C@H](C=C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H41NO4Si/c1-9-17-24(31)26(30-27(32)33-28(3,4)5)25(10-2)34-35(29(6,7)8,22-18-13-11-14-19-22)23-20-15-12-16-21-23/h9-16,18-21,24-26,31H,1-2,17H2,3-8H3,(H,30,32)/t24?,25-,26-/m0/s1 |
| InChIKey | YGKKEKIMASKHAM-WIXBZOCESA-N |
| XLogP | 4.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|