C25H35NO5Si — CID 10790036
ethyl N-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-4-methyloxolan-3-yl]carbamate (PubChem CID 10790036) has the molecular formula C25H35NO5Si and a molecular weight of 457.64 g/mol. Its IUPAC name is ethyl N-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-4-methyloxolan-3-yl]carbamate.
| Compound Name | ethyl N-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-4-methyloxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 10790036 |
| Molecular Formula | C25H35NO5Si |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | ethyl N-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-4-methyloxolan-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1C(O)O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C25H35NO5Si/c1-6-29-24(28)26-22-18(2)21(31-23(22)27)17-30-32(25(3,4)5,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21-23,27H,6,17H2,1-5H3,(H,26,28)/t18-,21+,22+,23?/m1/s1 |
| InChIKey | LEIUBMFLBNACQN-HTVKKVQNSA-N |
| XLogP | 3.03 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|