C30H37NO5Si — CID 10506136
benzyl N-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-4-methyloxolan-3-yl]carbamate (PubChem CID 10506136) has the molecular formula C30H37NO5Si and a molecular weight of 519.71 g/mol. Its IUPAC name is benzyl N-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-4-methyloxolan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-4-methyloxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 10506136 |
| Molecular Formula | C30H37NO5Si |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | benzyl N-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-4-methyloxolan-3-yl]carbamate |
| SMILES | C[C@@H]1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(O)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H37NO5Si/c1-22-26(36-28(32)27(22)31-29(33)34-20-23-14-8-5-9-15-23)21-35-37(30(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22,26-28,32H,20-21H2,1-4H3,(H,31,33)/t22-,26+,27+,28?/m1/s1 |
| InChIKey | WCRJRRHZSWNCCH-HUEFDWKGSA-N |
| XLogP | 4.21 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|