C35H49NO6Si — CID 11215617
tert-butyl N-[(2S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-1-phenylmethoxyheptan-2-yl]carbamate (PubChem CID 11215617) has the molecular formula C35H49NO6Si and a molecular weight of 607.86 g/mol. Its IUPAC name is tert-butyl N-[(2S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-1-phenylmethoxyheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-1-phenylmethoxyheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 11215617 |
| Molecular Formula | C35H49NO6Si |
| Molecular Weight | 607.86 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | tert-butyl N-[(2S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-1-phenylmethoxyheptan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)CO)COCc1ccccc1 |
| InChI | InChI=1S/C35H49NO6Si/c1-34(2,3)41-33(39)36-28(26-40-25-27-16-10-7-11-17-27)22-23-32(31(38)24-37)42-43(35(4,5)6,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-21,28,31-32,37-38H,22-26H2,1-6H3,(H,36,39)/t28-,31-,32-/m0/s1 |
| InChIKey | HWFPPCWLSJFYCD-MHDHXZMLSA-N |
| XLogP | 5.18 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|