C24H40N4O5Si — CID 11306447
tert-butyl N-[(1R,2S,3S,4R,5S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-phenylmethoxycyclohexyl]carbamate (PubChem CID 11306447) has the molecular formula C24H40N4O5Si and a molecular weight of 492.69 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3S,4R,5S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-phenylmethoxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3S,4R,5S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-phenylmethoxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 11306447 |
| Molecular Formula | C24H40N4O5Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | tert-butyl N-[(1R,2S,3S,4R,5S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-phenylmethoxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](N=[N+]=[N-])[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H40N4O5Si/c1-23(2,3)32-22(30)26-18-14-17(27-28-25)19(29)21(33-34(7,8)24(4,5)6)20(18)31-15-16-12-10-9-11-13-16/h9-13,17-21,29H,14-15H2,1-8H3,(H,26,30)/t17-,18+,19+,20-,21-/m0/s1 |
| InChIKey | LUTPGLIVLBKENX-ZPAWYTMASA-N |
| XLogP | 5.30 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|