C33H41NO6Si — CID 134920344
benzyl N-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(5-methyl-2,7,8-trioxabicyclo[3.2.1]octan-1-yl)propyl]carbamate (PubChem CID 134920344) has the molecular formula C33H41NO6Si and a molecular weight of 575.78 g/mol. Its IUPAC name is benzyl N-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(5-methyl-2,7,8-trioxabicyclo[3.2.1]octan-1-yl)propyl]carbamate.
| Compound Name | benzyl N-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(5-methyl-2,7,8-trioxabicyclo[3.2.1]octan-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 134920344 |
| Molecular Formula | C33H41NO6Si |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | benzyl N-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(5-methyl-2,7,8-trioxabicyclo[3.2.1]octan-1-yl)propyl]carbamate |
| SMILES | CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(NC(=O)OCc1ccccc1)C12OCCC(C)(CO1)O2 |
| InChI | InChI=1S/C33H41NO6Si/c1-25(39-41(31(2,3)4,27-17-11-7-12-18-27)28-19-13-8-14-20-28)29(33-37-22-21-32(5,40-33)24-38-33)34-30(35)36-23-26-15-9-6-10-16-26/h6-20,25,29H,21-24H2,1-5H3,(H,34,35) |
| InChIKey | YGICIUNCUKKMFN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|