C44H52FNO8 — CID 56954329
tert-butyl N-[(2S,3R)-3-fluoro-1-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypent-4-en-2-yl]carbamate (PubChem CID 56954329) has the molecular formula C44H52FNO8 and a molecular weight of 741.90 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-fluoro-1-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-fluoro-1-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 56954329 |
| Molecular Formula | C44H52FNO8 |
| Molecular Weight | 741.90 g/mol |
| Exact Mass | 741.37 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-fluoro-1-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypent-4-en-2-yl]carbamate |
| SMILES | C=C[C@@H](F)[C@H](CO[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H52FNO8/c1-5-36(45)37(46-43(47)54-44(2,3)4)30-52-42-41(51-29-35-24-16-9-17-25-35)40(50-28-34-22-14-8-15-23-34)39(49-27-33-20-12-7-13-21-33)38(53-42)31-48-26-32-18-10-6-11-19-32/h5-25,36-42H,1,26-31H2,2-4H3,(H,46,47)/t36-,37+,38-,39+,40+,41-,42+/m1/s1 |
| InChIKey | JGHJBWYJYXBPIQ-OPXTYKRXSA-N |
| XLogP | 8.12 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.90 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|