C38H39F3NO10PSe — CID 134856809
[(3S,6R)-6-bis(phenylmethoxy)phosphoryloxy-4-(phenylmethoxymethoxy)-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 134856809) has the molecular formula C38H39F3NO10PSe and a molecular weight of 836.66 g/mol. Its IUPAC name is [(3S,6R)-6-bis(phenylmethoxy)phosphoryloxy-4-(phenylmethoxymethoxy)-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(3S,6R)-6-bis(phenylmethoxy)phosphoryloxy-4-(phenylmethoxymethoxy)-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 134856809 |
| Molecular Formula | C38H39F3NO10PSe |
| Molecular Weight | 836.66 g/mol |
| Exact Mass | 837.14 |
| IUPAC Name | [(3S,6R)-6-bis(phenylmethoxy)phosphoryloxy-4-(phenylmethoxymethoxy)-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C[Se]c2ccccc2)O[C@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)C(NC(=O)C(F)(F)F)C1OCOCc1ccccc1 |
| InChI | InChI=1S/C38H39F3NO10PSe/c1-27(43)50-34-32(25-54-31-20-12-5-13-21-31)51-36(33(42-37(44)38(39,40)41)35(34)47-26-46-22-28-14-6-2-7-15-28)52-53(45,48-23-29-16-8-3-9-17-29)49-24-30-18-10-4-11-19-30/h2-21,32-36H,22-26H2,1H3,(H,42,44)/t32?,33?,34-,35?,36-/m1/s1 |
| InChIKey | NAWACCKKLFNGFE-UJFCHJEBSA-N |
| XLogP | 6.26 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|