C32H34F3NO6 — CID 134831714
2,2,2-trifluoro-N-[1-[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enyl]acetamide (PubChem CID 134831714) has the molecular formula C32H34F3NO6 and a molecular weight of 585.62 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 134831714 |
| Molecular Formula | C32H34F3NO6 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enyl]acetamide |
| SMILES | C=CC(NC(=O)C(F)(F)F)[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H34F3NO6/c1-3-25(36-31(37)32(33,34)35)26-27(39-19-22-13-7-4-8-14-22)28(40-20-23-15-9-5-10-16-23)29(30(38-2)42-26)41-21-24-17-11-6-12-18-24/h3-18,25-30H,1,19-21H2,2H3,(H,36,37)/t25?,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | SLSHJOMAORWJQM-CGZQQOGFSA-N |
| XLogP | 5.35 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|