C32H33F3NO10P — CID 134831975
[(3S,6R)-6-bis(phenylmethoxy)phosphoryloxy-2-methylidene-4-(phenylmethoxymethoxy)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 134831975) has the molecular formula C32H33F3NO10P and a molecular weight of 679.58 g/mol. Its IUPAC name is [(3S,6R)-6-bis(phenylmethoxy)phosphoryloxy-2-methylidene-4-(phenylmethoxymethoxy)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(3S,6R)-6-bis(phenylmethoxy)phosphoryloxy-2-methylidene-4-(phenylmethoxymethoxy)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 134831975 |
| Molecular Formula | C32H33F3NO10P |
| Molecular Weight | 679.58 g/mol |
| Exact Mass | 679.18 |
| IUPAC Name | [(3S,6R)-6-bis(phenylmethoxy)phosphoryloxy-2-methylidene-4-(phenylmethoxymethoxy)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | C=C1O[C@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)C(NC(=O)C(F)(F)F)C(OCOCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H33F3NO10P/c1-22-28(45-23(2)37)29(41-21-40-18-24-12-6-3-7-13-24)27(36-31(38)32(33,34)35)30(44-22)46-47(39,42-19-25-14-8-4-9-15-25)43-20-26-16-10-5-11-17-26/h3-17,27-30H,1,18-21H2,2H3,(H,36,38)/t27?,28-,29?,30-/m1/s1 |
| InChIKey | SPQAMHLKAHJWQX-NJYYWGPDSA-N |
| XLogP | 5.95 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|