C30H40F3NO7SeSi — CID 134856810
[(3S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxymethoxy)-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 134856810) has the molecular formula C30H40F3NO7SeSi and a molecular weight of 690.69 g/mol. Its IUPAC name is [(3S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxymethoxy)-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(3S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxymethoxy)-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 134856810 |
| Molecular Formula | C30H40F3NO7SeSi |
| Molecular Weight | 690.69 g/mol |
| Exact Mass | 691.17 |
| IUPAC Name | [(3S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxymethoxy)-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C[Se]c2ccccc2)O[C@@H](O[Si](C)(C)C(C)(C)C)C(NC(=O)C(F)(F)F)C1OCOCc1ccccc1 |
| InChI | InChI=1S/C30H40F3NO7SeSi/c1-20(35)39-25-23(18-42-22-15-11-8-12-16-22)40-27(41-43(5,6)29(2,3)4)24(34-28(36)30(31,32)33)26(25)38-19-37-17-21-13-9-7-10-14-21/h7-16,23-27H,17-19H2,1-6H3,(H,34,36)/t23?,24?,25-,26?,27+/m1/s1 |
| InChIKey | FELSWCUDFGNCRX-OWNWXFJWSA-N |
| XLogP | 4.72 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|