C46H46F3NO8 — CID 23241395
[(1S,2R,3S,4R,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] acetate (PubChem CID 23241395) has the molecular formula C46H46F3NO8 and a molecular weight of 797.87 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] acetate.
| Compound Name | [(1S,2R,3S,4R,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] acetate |
|---|---|
| PubChem CID | 23241395 |
| Molecular Formula | C46H46F3NO8 |
| Molecular Weight | 797.87 g/mol |
| Exact Mass | 797.32 |
| IUPAC Name | [(1S,2R,3S,4R,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](NC(=O)C(F)(F)F)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@]1(COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C46H46F3NO8/c1-33(51)58-42-39(50-44(52)46(47,48)49)40(54-28-35-19-9-3-10-20-35)41(55-29-36-21-11-4-12-22-36)43(56-30-37-23-13-5-14-24-37)45(42,57-31-38-25-15-6-16-26-38)32-53-27-34-17-7-2-8-18-34/h2-26,39-43H,27-32H2,1H3,(H,50,52)/t39-,40+,41-,42+,43+,45-/m1/s1 |
| InChIKey | VDTNVYWVFYQPJA-XEMMMROJSA-N |
| XLogP | 7.91 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.87 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |