C38H41NO5 — CID 15515769
N-[(1S,2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-bicyclo[4.1.0]heptanyl]acetamide (PubChem CID 15515769) has the molecular formula C38H41NO5 and a molecular weight of 591.75 g/mol. Its IUPAC name is N-[(1S,2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-bicyclo[4.1.0]heptanyl]acetamide.
| Compound Name | N-[(1S,2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-bicyclo[4.1.0]heptanyl]acetamide |
|---|---|
| PubChem CID | 15515769 |
| Molecular Formula | C38H41NO5 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | N-[(1S,2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-bicyclo[4.1.0]heptanyl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@]2(COCc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C38H41NO5/c1-28(40)39-34-33-22-38(33,27-41-23-29-14-6-2-7-15-29)37(44-26-32-20-12-5-13-21-32)36(43-25-31-18-10-4-11-19-31)35(34)42-24-30-16-8-3-9-17-30/h2-21,33-37H,22-27H2,1H3,(H,39,40)/t33-,34+,35?,36-,37+,38+/m1/s1 |
| InChIKey | SNILGZZCWDAVSM-ILIIYOJGSA-N |
| XLogP | 6.48 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |