C16H18F3NO2 — CID 101136351
2,2,2-trifluoro-N-[(1S,6R)-6-(phenylmethoxymethyl)cyclohex-3-en-1-yl]acetamide (PubChem CID 101136351) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S,6R)-6-(phenylmethoxymethyl)cyclohex-3-en-1-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1S,6R)-6-(phenylmethoxymethyl)cyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 101136351 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S,6R)-6-(phenylmethoxymethyl)cyclohex-3-en-1-yl]acetamide |
| SMILES | O=C(N[C@H]1CC=CC[C@H]1COCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO2/c17-16(18,19)15(21)20-14-9-5-4-8-13(14)11-22-10-12-6-2-1-3-7-12/h1-7,13-14H,8-11H2,(H,20,21)/t13-,14-/m0/s1 |
| InChIKey | VSTBPISQTKBZBU-KBPBESRZSA-N |
| XLogP | 3.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|