C28H30O3 — CID 138969880
[(5R,6S)-5,6-bis(phenylmethoxy)cyclohex-3-en-1-yl]methoxymethylbenzene (PubChem CID 138969880) has the molecular formula C28H30O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is [(5R,6S)-5,6-bis(phenylmethoxy)cyclohex-3-en-1-yl]methoxymethylbenzene.
| Compound Name | [(5R,6S)-5,6-bis(phenylmethoxy)cyclohex-3-en-1-yl]methoxymethylbenzene |
|---|---|
| PubChem CID | 138969880 |
| Molecular Formula | C28H30O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [(5R,6S)-5,6-bis(phenylmethoxy)cyclohex-3-en-1-yl]methoxymethylbenzene |
| SMILES | C1=C[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C(COCc2ccccc2)C1 |
| InChI | InChI=1S/C28H30O3/c1-4-11-23(12-5-1)19-29-22-26-17-10-18-27(30-20-24-13-6-2-7-14-24)28(26)31-21-25-15-8-3-9-16-25/h1-16,18,26-28H,17,19-22H2/t26?,27-,28+/m1/s1 |
| InChIKey | XVHMLNINKZTSQU-OEBVTXOESA-N |
| XLogP | 5.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|