C20H21BrHgO2 — CID 101008861
CID 101008861 (PubChem CID 101008861) has the molecular formula C20H21BrHgO2 and a molecular weight of 573.88 g/mol.
| Compound Name | CID 101008861 |
|---|---|
| PubChem CID | 101008861 |
| Molecular Formula | C20H21BrHgO2 |
| Molecular Weight | 573.88 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | — |
| SMILES | [Br-].[CH2][C@@H]1C=C[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1.[Hg+] |
| InChI | InChI=1S/C20H21O2.BrH.Hg/c1-16-12-13-19(21-14-17-8-4-2-5-9-17)20(16)22-15-18-10-6-3-7-11-18;;/h2-13,16,19-20H,1,14-15H2;1H;/q;;+1/p-1/t16-,19+,20-;;/m1../s1 |
| InChIKey | UFRRDYDTCREBNB-YBYPNTNXSA-M |
| XLogP | 1.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.88 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|