C28H31NO3 — CID 174039635
(3S,4S,5R)-3,4,5-tris(phenylmethoxy)-1,2,3,4,5,8-hexahydroazocine (PubChem CID 174039635) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is (3S,4S,5R)-3,4,5-tris(phenylmethoxy)-1,2,3,4,5,8-hexahydroazocine.
| Compound Name | (3S,4S,5R)-3,4,5-tris(phenylmethoxy)-1,2,3,4,5,8-hexahydroazocine |
|---|---|
| PubChem CID | 174039635 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (3S,4S,5R)-3,4,5-tris(phenylmethoxy)-1,2,3,4,5,8-hexahydroazocine |
| SMILES | C1=C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CNC1 |
| InChI | InChI=1S/C28H31NO3/c1-4-11-23(12-5-1)20-30-26-17-10-18-29-19-27(31-21-24-13-6-2-7-14-24)28(26)32-22-25-15-8-3-9-16-25/h1-17,26-29H,18-22H2/t26-,27+,28+/m1/s1 |
| InChIKey | MAMMUKCFUJKYKD-PKTNWEFCSA-N |
| XLogP | 4.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|