C56H56O6 — CID 10941831
[(1S,2R,6R)-2,6-bis(phenylmethoxy)-4-[(E)-2-[(3R,4S,5R)-3,4,5-tris(phenylmethoxy)cyclohexen-1-yl]ethenyl]cyclohex-3-en-1-yl]oxymethylbenzene (PubChem CID 10941831) has the molecular formula C56H56O6 and a molecular weight of 825.06 g/mol. Its IUPAC name is [(1S,2R,6R)-2,6-bis(phenylmethoxy)-4-[(E)-2-[(3R,4S,5R)-3,4,5-tris(phenylmethoxy)cyclohexen-1-yl]ethenyl]cyclohex-3-en-1-yl]oxymethylbenzene.
| Compound Name | [(1S,2R,6R)-2,6-bis(phenylmethoxy)-4-[(E)-2-[(3R,4S,5R)-3,4,5-tris(phenylmethoxy)cyclohexen-1-yl]ethenyl]cyclohex-3-en-1-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 10941831 |
| Molecular Formula | C56H56O6 |
| Molecular Weight | 825.06 g/mol |
| Exact Mass | 824.41 |
| IUPAC Name | [(1S,2R,6R)-2,6-bis(phenylmethoxy)-4-[(E)-2-[(3R,4S,5R)-3,4,5-tris(phenylmethoxy)cyclohexen-1-yl]ethenyl]cyclohex-3-en-1-yl]oxymethylbenzene |
| SMILES | C1=C(/C=C/C2=C[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2)C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C56H56O6/c1-7-19-43(20-8-1)37-57-51-33-49(34-52(58-38-44-21-9-2-10-22-44)55(51)61-41-47-27-15-5-16-28-47)31-32-50-35-53(59-39-45-23-11-3-12-24-45)56(62-42-48-29-17-6-18-30-48)54(36-50)60-40-46-25-13-4-14-26-46/h1-33,35,51-56H,34,36-42H2/b32-31+/t51-,52-,53-,54-,55-,56-/m1/s1 |
| InChIKey | FLNHZPZQYABWOF-AZZDSBHASA-N |
| XLogP | 11.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.06 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |