C26H27NO4 — CID 90180939
(2R,3S,4S)-1-oxido-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium (PubChem CID 90180939) has the molecular formula C26H27NO4 and a molecular weight of 417.50 g/mol. Its IUPAC name is (2R,3S,4S)-1-oxido-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium.
| Compound Name | (2R,3S,4S)-1-oxido-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 90180939 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2R,3S,4S)-1-oxido-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium |
| SMILES | [O-][N+]1=C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c28-27-16-25(30-18-22-12-6-2-7-13-22)26(31-19-23-14-8-3-9-15-23)24(27)20-29-17-21-10-4-1-5-11-21/h1-16,24-26H,17-20H2/t24-,25+,26+/m1/s1 |
| InChIKey | FYVRCXABOYBHKY-ZNZIZOMTSA-N |
| XLogP | 4.34 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|