C26H28O3S — CID 71010582
(3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolane (PubChem CID 71010582) has the molecular formula C26H28O3S and a molecular weight of 420.57 g/mol. Its IUPAC name is (3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolane.
| Compound Name | (3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolane |
|---|---|
| PubChem CID | 71010582 |
| Molecular Formula | C26H28O3S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolane |
| SMILES | c1ccc(COCC2SC[C@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28O3S/c1-4-10-21(11-5-1)16-27-19-25-26(29-18-23-14-8-3-9-15-23)24(20-30-25)28-17-22-12-6-2-7-13-22/h1-15,24-26H,16-20H2/t24-,25?,26-/m0/s1 |
| InChIKey | IISDOLHHPNAZII-ZURQMKNRSA-N |
| XLogP | 5.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |