C19H20O3S — CID 10758680
(4R,5S)-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-3-one (PubChem CID 10758680) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is (4R,5S)-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-3-one.
| Compound Name | (4R,5S)-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-3-one |
|---|---|
| PubChem CID | 10758680 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (4R,5S)-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-3-one |
| SMILES | O=C1CS[C@@H](COCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H20O3S/c20-17-14-23-18(13-21-11-15-7-3-1-4-8-15)19(17)22-12-16-9-5-2-6-10-16/h1-10,18-19H,11-14H2/t18-,19+/m0/s1 |
| InChIKey | PVFQYHPKHJOKPJ-RBUKOAKNSA-N |
| XLogP | 3.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |