C21H24O5 — CID 11302737
(2S,3S,6S)-2-methoxy-3-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-one (PubChem CID 11302737) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2S,3S,6S)-2-methoxy-3-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-one.
| Compound Name | (2S,3S,6S)-2-methoxy-3-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-one |
|---|---|
| PubChem CID | 11302737 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2S,3S,6S)-2-methoxy-3-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-one |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)CC(=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H24O5/c1-23-21-20(25-14-17-10-6-3-7-11-17)19(22)12-18(26-21)15-24-13-16-8-4-2-5-9-16/h2-11,18,20-21H,12-15H2,1H3/t18-,20+,21-/m0/s1 |
| InChIKey | CVRGCXLYUKNREX-TYPHKJRUSA-N |
| XLogP | 3.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |