C49H54O10 — CID 102230376
(2R,3R,7R)-7-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxepan-4-one (PubChem CID 102230376) has the molecular formula C49H54O10 and a molecular weight of 802.96 g/mol. Its IUPAC name is (2R,3R,7R)-7-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxepan-4-one.
| Compound Name | (2R,3R,7R)-7-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxepan-4-one |
|---|---|
| PubChem CID | 102230376 |
| Molecular Formula | C49H54O10 |
| Molecular Weight | 802.96 g/mol |
| Exact Mass | 802.37 |
| IUPAC Name | (2R,3R,7R)-7-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxepan-4-one |
| SMILES | CO[C@H]1O[C@H](CO[C@H]2CCC(=O)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H54O10/c1-51-49-48(57-33-40-25-15-6-16-26-40)47(56-32-39-23-13-5-14-24-39)46(55-31-38-21-11-4-12-22-38)43(59-49)35-53-44-28-27-41(50)45(54-30-37-19-9-3-10-20-37)42(58-44)34-52-29-36-17-7-2-8-18-36/h2-26,42-49H,27-35H2,1H3/t42-,43-,44-,45+,46-,47+,48-,49+/m1/s1 |
| InChIKey | SIXRDGGZPUWBCM-VZQNJMBISA-N |
| XLogP | 8.01 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.96 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |