C28H32O4Si — CID 10928642
(2R,3S,6R)-6-[dimethyl(phenyl)silyl]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxan-4-one (PubChem CID 10928642) has the molecular formula C28H32O4Si and a molecular weight of 460.65 g/mol. Its IUPAC name is (2R,3S,6R)-6-[dimethyl(phenyl)silyl]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxan-4-one.
| Compound Name | (2R,3S,6R)-6-[dimethyl(phenyl)silyl]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxan-4-one |
|---|---|
| PubChem CID | 10928642 |
| Molecular Formula | C28H32O4Si |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (2R,3S,6R)-6-[dimethyl(phenyl)silyl]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxan-4-one |
| SMILES | C[Si](C)(c1ccccc1)[C@@H]1CC(=O)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C28H32O4Si/c1-33(2,24-16-10-5-11-17-24)27-18-25(29)28(31-20-23-14-8-4-9-15-23)26(32-27)21-30-19-22-12-6-3-7-13-22/h3-17,26-28H,18-21H2,1-2H3/t26-,27-,28-/m1/s1 |
| InChIKey | AUSVQOHAYSXFQD-JCYYIGJDSA-N |
| XLogP | 4.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|