C32H48O4Sn — CID 11814134
(2R,3S,6R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-tributylstannyloxan-4-one (PubChem CID 11814134) has the molecular formula C32H48O4Sn and a molecular weight of 615.44 g/mol. Its IUPAC name is (2R,3S,6R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-tributylstannyloxan-4-one.
| Compound Name | (2R,3S,6R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-tributylstannyloxan-4-one |
|---|---|
| PubChem CID | 11814134 |
| Molecular Formula | C32H48O4Sn |
| Molecular Weight | 615.44 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | (2R,3S,6R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-tributylstannyloxan-4-one |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H]1CC(=O)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C20H21O4.3C4H9.Sn/c21-18-11-12-23-19(15-22-13-16-7-3-1-4-8-16)20(18)24-14-17-9-5-2-6-10-17;3*1-3-4-2;/h1-10,12,19-20H,11,13-15H2;3*1,3-4H2,2H3;/t19-,20-;;;;/m1..../s1 |
| InChIKey | UNSSLXYBPBROSK-XQHCZWOQSA-N |
| XLogP | 7.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.44 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |